Meodipt:
{{drugbox
| drug_name = Methylenedioxynitazene
| image = Methylenedioxynitazene_structure.png
| legal_UK =
| legal_DE =
| C = 21 | H = 24 | N = 4 | O = 4
| IUPAC_name = 2-(2-((1,3-benzodioxol-5-yl)methyl)-5-nitro-1H-benzo[d]imidazol-1-yl)-N,N-diethylethan-1-amine
| CAS_number =
| UNII =
| ChemSpiderID =
| PubChem =
| smiles = CCN(CC)CCn4c(Cc2ccc1OCOc1c2)nc3cc([N+]([O-])=O)ccc34
| StdInChI=
| StdInChIKey =
}}
'''Methylenedioxynitazene''' ('''3,4-Methylenedioxynitazene''') is a [[benzimidazole]] derivative which has been sold as a [[designer drug]] over the internet and presumably has [[opioid]] effects. It is an analogue of [[etonitazene]] where the benzyl ring is substituted with a 3,4-methylenedioxy ring system rather than an ethoxy group. It was first reported in the UK in early 2024.<ref>{{cite web | url = https://assets.publishing.service.g...le+and+piperidine+benzimidazolone+opioids.pdf | title = Fourth addendum to ACMD report on the use and harms of 2-benzyl benzimidazole (‘nitazene’) and piperidine benzimidazolone (‘brorphine-like’) opioids. | work = Advisory Council on the Misuse of Drugs | date = 5 April 2024 }}</ref>
== See also ==
* [[Etoetonitazene]]
* [[Etonitazepyne]]
* [[Isotonitazene]]
* [[List of benzimidazole opioids]]
== References ==
{{reflist}}
{{Opioids}}
[[Category:Analgesics]]
[[Categoryesigner drugs]]
[[Category:Benzimidazole opioids]]
[[Category:Aromatic ethers]]
[[Categoryiethylamino compounds]]
{{Analgesic-stub}}
Okumaya devam et...
{{drugbox
| drug_name = Methylenedioxynitazene
| image = Methylenedioxynitazene_structure.png
| legal_UK =
| legal_DE =
| C = 21 | H = 24 | N = 4 | O = 4
| IUPAC_name = 2-(2-((1,3-benzodioxol-5-yl)methyl)-5-nitro-1H-benzo[d]imidazol-1-yl)-N,N-diethylethan-1-amine
| CAS_number =
| UNII =
| ChemSpiderID =
| PubChem =
| smiles = CCN(CC)CCn4c(Cc2ccc1OCOc1c2)nc3cc([N+]([O-])=O)ccc34
| StdInChI=
| StdInChIKey =
}}
'''Methylenedioxynitazene''' ('''3,4-Methylenedioxynitazene''') is a [[benzimidazole]] derivative which has been sold as a [[designer drug]] over the internet and presumably has [[opioid]] effects. It is an analogue of [[etonitazene]] where the benzyl ring is substituted with a 3,4-methylenedioxy ring system rather than an ethoxy group. It was first reported in the UK in early 2024.<ref>{{cite web | url = https://assets.publishing.service.g...le+and+piperidine+benzimidazolone+opioids.pdf | title = Fourth addendum to ACMD report on the use and harms of 2-benzyl benzimidazole (‘nitazene’) and piperidine benzimidazolone (‘brorphine-like’) opioids. | work = Advisory Council on the Misuse of Drugs | date = 5 April 2024 }}</ref>
== See also ==
* [[Etoetonitazene]]
* [[Etonitazepyne]]
* [[Isotonitazene]]
* [[List of benzimidazole opioids]]
== References ==
{{reflist}}
{{Opioids}}
[[Category:Analgesics]]
[[Categoryesigner drugs]]
[[Category:Benzimidazole opioids]]
[[Category:Aromatic ethers]]
[[Categoryiethylamino compounds]]
{{Analgesic-stub}}
Okumaya devam et...